C20H23N3O4 — CID 108963634
ethyl 2-[[2,2-dimethyl-3-oxo-3-(pyridin-3-ylmethylamino)propanoyl]amino]benzoate (PubChem CID 108963634) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is ethyl 2-[[2,2-dimethyl-3-oxo-3-(pyridin-3-ylmethylamino)propanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[2,2-dimethyl-3-oxo-3-(pyridin-3-ylmethylamino)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108963634 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | ethyl 2-[[2,2-dimethyl-3-oxo-3-(pyridin-3-ylmethylamino)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(C)(C)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C20H23N3O4/c1-4-27-17(24)15-9-5-6-10-16(15)23-19(26)20(2,3)18(25)22-13-14-8-7-11-21-12-14/h5-12H,4,13H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | FBIZUYXTZRWHEW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|