C13H13NO3 — CID 10059772
1-(13,14-dioxa-8-azatetracyclo[7.3.2.01,9.02,7]tetradeca-2,4,6-trien-8-yl)ethanone (PubChem CID 10059772) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-(13,14-dioxa-8-azatetracyclo[7.3.2.01,9.02,7]tetradeca-2,4,6-trien-8-yl)ethanone.
| Compound Name | 1-(13,14-dioxa-8-azatetracyclo[7.3.2.01,9.02,7]tetradeca-2,4,6-trien-8-yl)ethanone |
|---|---|
| PubChem CID | 10059772 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-(13,14-dioxa-8-azatetracyclo[7.3.2.01,9.02,7]tetradeca-2,4,6-trien-8-yl)ethanone |
| SMILES | CC(=O)N1c2ccccc2C23CCCC12OO3 |
| InChI | InChI=1S/C13H13NO3/c1-9(15)14-11-6-3-2-5-10(11)12-7-4-8-13(12,14)17-16-12/h2-3,5-6H,4,7-8H2,1H3 |
| InChIKey | DAEVHWXDKSPGSU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|