C16H14INO — CID 102070490
1-[8-(iodomethyl)-8-phenyl-7-azabicyclo[4.2.0]octa-1,3,5-trien-7-yl]ethanone (PubChem CID 102070490) has the molecular formula C16H14INO and a molecular weight of 363.20 g/mol. Its IUPAC name is 1-[8-(iodomethyl)-8-phenyl-7-azabicyclo[4.2.0]octa-1,3,5-trien-7-yl]ethanone.
| Compound Name | 1-[8-(iodomethyl)-8-phenyl-7-azabicyclo[4.2.0]octa-1,3,5-trien-7-yl]ethanone |
|---|---|
| PubChem CID | 102070490 |
| Molecular Formula | C16H14INO |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.01 |
| IUPAC Name | 1-[8-(iodomethyl)-8-phenyl-7-azabicyclo[4.2.0]octa-1,3,5-trien-7-yl]ethanone |
| SMILES | CC(=O)N1c2ccccc2C1(CI)c1ccccc1 |
| InChI | InChI=1S/C16H14INO/c1-12(19)18-15-10-6-5-9-14(15)16(18,11-17)13-7-3-2-4-8-13/h2-10H,11H2,1H3 |
| InChIKey | OYCXFYOLFKKQGC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|