C24H19NO3 — CID 10737820
1-acetyl-3',3'-diphenylspiro[indole-3,2'-oxetane]-2-one (PubChem CID 10737820) has the molecular formula C24H19NO3 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-acetyl-3',3'-diphenylspiro[indole-3,2'-oxetane]-2-one.
| Compound Name | 1-acetyl-3',3'-diphenylspiro[indole-3,2'-oxetane]-2-one |
|---|---|
| PubChem CID | 10737820 |
| Molecular Formula | C24H19NO3 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 1-acetyl-3',3'-diphenylspiro[indole-3,2'-oxetane]-2-one |
| SMILES | CC(=O)N1C(=O)C2(OCC2(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H19NO3/c1-17(26)25-21-15-9-8-14-20(21)24(22(25)27)23(16-28-24,18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15H,16H2,1H3 |
| InChIKey | OGRCKBDUMJGWLB-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |