C17H12N2O4 — CID 26183224
(2R)-1'-acetylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione (PubChem CID 26183224) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2R)-1'-acetylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione.
| Compound Name | (2R)-1'-acetylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 26183224 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | (2R)-1'-acetylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
| SMILES | CC(=O)N1C(=O)[C@@]2(NC(=O)c3ccccc3O2)c2ccccc21 |
| InChI | InChI=1S/C17H12N2O4/c1-10(20)19-13-8-4-3-7-12(13)17(16(19)22)18-15(21)11-6-2-5-9-14(11)23-17/h2-9H,1H3,(H,18,21)/t17-/m1/s1 |
| InChIKey | KIUAAUFXGIOUQR-QGZVFWFLSA-N |
| XLogP | 1.55 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |