C18H13NO3 — CID 101072475
1-acetyl-3'-phenylspiro[indole-3,2'-oxete]-2-one (PubChem CID 101072475) has the molecular formula C18H13NO3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 1-acetyl-3'-phenylspiro[indole-3,2'-oxete]-2-one.
| Compound Name | 1-acetyl-3'-phenylspiro[indole-3,2'-oxete]-2-one |
|---|---|
| PubChem CID | 101072475 |
| Molecular Formula | C18H13NO3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-acetyl-3'-phenylspiro[indole-3,2'-oxete]-2-one |
| SMILES | CC(=O)N1C(=O)C2(OC=C2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C18H13NO3/c1-12(20)19-16-10-6-5-9-14(16)18(17(19)21)15(11-22-18)13-7-3-2-4-8-13/h2-11H,1H3 |
| InChIKey | OXNOIYXTZNJSSO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |