C20H20N2O3 — CID 41452929
(2R)-1'-pentylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione (PubChem CID 41452929) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2R)-1'-pentylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione.
| Compound Name | (2R)-1'-pentylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 41452929 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2R)-1'-pentylspiro[3H-1,3-benzoxazine-2,3'-indole]-2',4-dione |
| SMILES | CCCCCN1C(=O)[C@@]2(NC(=O)c3ccccc3O2)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O3/c1-2-3-8-13-22-16-11-6-5-10-15(16)20(19(22)24)21-18(23)14-9-4-7-12-17(14)25-20/h4-7,9-12H,2-3,8,13H2,1H3,(H,21,23)/t20-/m1/s1 |
| InChIKey | DVWDDBXLNKNRKI-HXUWFJFHSA-N |
| XLogP | 3.20 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|