C26H25N3O2 — CID 41457149
(2S)-1'-pentyl-3-phenylspiro[1H-quinazoline-2,3'-indole]-2',4-dione (PubChem CID 41457149) has the molecular formula C26H25N3O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is (2S)-1'-pentyl-3-phenylspiro[1H-quinazoline-2,3'-indole]-2',4-dione.
| Compound Name | (2S)-1'-pentyl-3-phenylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 41457149 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | (2S)-1'-pentyl-3-phenylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
| SMILES | CCCCCN1C(=O)[C@]2(Nc3ccccc3C(=O)N2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H25N3O2/c1-2-3-11-18-28-23-17-10-8-15-21(23)26(25(28)31)27-22-16-9-7-14-20(22)24(30)29(26)19-12-5-4-6-13-19/h4-10,12-17,27H,2-3,11,18H2,1H3/t26-/m0/s1 |
| InChIKey | YPMFIAPJFSJZLS-SANMLTNESA-N |
| XLogP | 5.15 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|