C25H23N3O3 — CID 42583440
(2R)-3-(4-ethoxyphenyl)-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione (PubChem CID 42583440) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is (2R)-3-(4-ethoxyphenyl)-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione.
| Compound Name | (2R)-3-(4-ethoxyphenyl)-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 42583440 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | (2R)-3-(4-ethoxyphenyl)-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
| SMILES | CCOc1ccc(N2C(=O)c3ccccc3N[C@@]23C(=O)N(CC)c2ccccc23)cc1 |
| InChI | InChI=1S/C25H23N3O3/c1-3-27-22-12-8-6-10-20(22)25(24(27)30)26-21-11-7-5-9-19(21)23(29)28(25)17-13-15-18(16-14-17)31-4-2/h5-16,26H,3-4H2,1-2H3/t25-/m1/s1 |
| InChIKey | OGTCCNKUCAZNMO-RUZDIDTESA-N |
| XLogP | 4.38 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |