C24H21N3O2 — CID 41457150
(2R)-3-benzyl-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione (PubChem CID 41457150) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is (2R)-3-benzyl-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione.
| Compound Name | (2R)-3-benzyl-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 41457150 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (2R)-3-benzyl-1'-ethylspiro[1H-quinazoline-2,3'-indole]-2',4-dione |
| SMILES | CCN1C(=O)[C@@]2(Nc3ccccc3C(=O)N2Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O2/c1-2-26-21-15-9-7-13-19(21)24(23(26)29)25-20-14-8-6-12-18(20)22(28)27(24)16-17-10-4-3-5-11-17/h3-15,25H,2,16H2,1H3/t24-/m1/s1 |
| InChIKey | GVPVBYNTKUIGGV-XMMPIXPASA-N |
| XLogP | 3.97 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |