About (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one
(2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one (PubChem CID 41387372) has the molecular formula C18H16N2O3
and a molecular weight of 308.34 g/mol. Its IUPAC name is (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
| PubChem CID | 41387372 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
| SMILES | CC(=O)N1c2ccccc2CO[C@@]12C(=O)N(C)c1ccccc12 |
| InChI | InChI=1S/C18H16N2O3/c1-12(21)20-15-9-5-3-7-13(15)11-23-18(20)14-8-4-6-10-16(14)19(2)17(18)22/h3-10H,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | AXIUANWBJOHZHY-SFHVURJKSA-N |
| XLogP | 2.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
The IUPAC name of (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one (CID 41387372) is (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one.
What is the SMILES notation for (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
The canonical SMILES for (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one is CC(=O)N1c2ccccc2CO[C@@]12C(=O)N(C)c1ccccc12.
What is the InChIKey of (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
The InChIKey is AXIUANWBJOHZHY-SFHVURJKSA-N. The full InChI is InChI=1S/C18H16N2O3/c1-12(21)20-15-9-5-3-7-13(15)11-23-18(20)14-8-4-6-10-16(14)19(2)17(18)22/h3-10H,11H2,1-2H3/t18-/m0/s1.
What are the key properties of (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one?
(2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one has a molecular weight of 308.34 g/mol, XLogP of 2.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-acetyl-1'-methylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one is sourced from PubChem (CID 41387372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).