C20H20N2O3 — CID 41387421
(2R)-1'-ethyl-1-propanoylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one (PubChem CID 41387421) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (2R)-1'-ethyl-1-propanoylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one.
| Compound Name | (2R)-1'-ethyl-1-propanoylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 41387421 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2R)-1'-ethyl-1-propanoylspiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
| SMILES | CCC(=O)N1c2ccccc2CO[C@]12C(=O)N(CC)c1ccccc12 |
| InChI | InChI=1S/C20H20N2O3/c1-3-18(23)22-16-11-7-5-9-14(16)13-25-20(22)15-10-6-8-12-17(15)21(4-2)19(20)24/h5-12H,3-4,13H2,1-2H3/t20-/m1/s1 |
| InChIKey | JORZMTPOQWOHPO-HXUWFJFHSA-N |
| XLogP | 3.18 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |