C20H19NO2 — CID 172635621
(2S,3S)-2-methyl-1-propanoylspiro[2H-indole-3,2'-3H-indene]-1'-one (PubChem CID 172635621) has the molecular formula C20H19NO2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2S,3S)-2-methyl-1-propanoylspiro[2H-indole-3,2'-3H-indene]-1'-one.
| Compound Name | (2S,3S)-2-methyl-1-propanoylspiro[2H-indole-3,2'-3H-indene]-1'-one |
|---|---|
| PubChem CID | 172635621 |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | (2S,3S)-2-methyl-1-propanoylspiro[2H-indole-3,2'-3H-indene]-1'-one |
| SMILES | CCC(=O)N1c2ccccc2[C@@]2(Cc3ccccc3C2=O)[C@@H]1C |
| InChI | InChI=1S/C20H19NO2/c1-3-18(22)21-13(2)20(16-10-6-7-11-17(16)21)12-14-8-4-5-9-15(14)19(20)23/h4-11,13H,3,12H2,1-2H3/t13-,20+/m0/s1 |
| InChIKey | QQHRQBULYDSWMM-RNODOKPDSA-N |
| XLogP | 3.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |