C24H20N2O4 — CID 41387424
(2S)-1'-ethyl-1-[(E)-3-(furan-2-yl)prop-2-enoyl]spiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one (PubChem CID 41387424) has the molecular formula C24H20N2O4 and a molecular weight of 400.43 g/mol. Its IUPAC name is (2S)-1'-ethyl-1-[(E)-3-(furan-2-yl)prop-2-enoyl]spiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one.
| Compound Name | (2S)-1'-ethyl-1-[(E)-3-(furan-2-yl)prop-2-enoyl]spiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
|---|---|
| PubChem CID | 41387424 |
| Molecular Formula | C24H20N2O4 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | (2S)-1'-ethyl-1-[(E)-3-(furan-2-yl)prop-2-enoyl]spiro[4H-3,1-benzoxazine-2,3'-indole]-2'-one |
| SMILES | CCN1C(=O)[C@@]2(OCc3ccccc3N2C(=O)/C=C/c2ccco2)c2ccccc21 |
| InChI | InChI=1S/C24H20N2O4/c1-2-25-21-12-6-4-10-19(21)24(23(25)28)26(20-11-5-3-8-17(20)16-30-24)22(27)14-13-18-9-7-15-29-18/h3-15H,2,16H2,1H3/b14-13+/t24-/m0/s1 |
| InChIKey | OKNCJLGAICYLDV-XXFRDUSWSA-N |
| XLogP | 4.08 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|