C10H14O5S — CID 10060466
[(3aR,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-6-yl]methyl acetate (PubChem CID 10060466) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is [(3aR,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-6-yl]methyl acetate.
| Compound Name | [(3aR,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-6-yl]methyl acetate |
|---|---|
| PubChem CID | 10060466 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | [(3aR,6S,6aS)-2,2-dimethyl-4-oxo-6,6a-dihydro-3aH-thieno[3,4-d][1,3]dioxol-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1SC(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C10H14O5S/c1-5(11)13-4-6-7-8(9(12)16-6)15-10(2,3)14-7/h6-8H,4H2,1-3H3/t6-,7+,8+/m0/s1 |
| InChIKey | CBZPHPQCWDFKFW-XLPZGREQSA-N |
| XLogP | 0.71 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|