C9H16O4S — CID 160933404
(3aR,6S,6aS)-2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one;methane (PubChem CID 160933404) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is (3aR,6S,6aS)-2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one;methane.
| Compound Name | (3aR,6S,6aS)-2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one;methane |
|---|---|
| PubChem CID | 160933404 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | (3aR,6S,6aS)-2,2-dimethyl-6-(sulfanylmethyl)-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-one;methane |
| SMILES | C.CC1(C)O[C@@H]2[C@@H](CS)OC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C8H12O4S.CH4/c1-8(2)11-5-4(3-13)10-7(9)6(5)12-8;/h4-6,13H,3H2,1-2H3;1H4/t4-,5-,6-;/m1./s1 |
| InChIKey | STOFVHYYXMTCCU-RWOHWRPJSA-N |
| XLogP | 1.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|