C14H21FO3 — CID 10060972
1-fluoro-4-(2,2,2-triethoxyethyl)benzene (PubChem CID 10060972) has the molecular formula C14H21FO3 and a molecular weight of 256.32 g/mol. Its IUPAC name is 1-fluoro-4-(2,2,2-triethoxyethyl)benzene.
| Compound Name | 1-fluoro-4-(2,2,2-triethoxyethyl)benzene |
|---|---|
| PubChem CID | 10060972 |
| Molecular Formula | C14H21FO3 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-fluoro-4-(2,2,2-triethoxyethyl)benzene |
| SMILES | CCOC(Cc1ccc(F)cc1)(OCC)OCC |
| InChI | InChI=1S/C14H21FO3/c1-4-16-14(17-5-2,18-6-3)11-12-7-9-13(15)10-8-12/h7-10H,4-6,11H2,1-3H3 |
| InChIKey | GEJWBGKLRMOICV-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|