C30H35ClN2O2 — CID 100616473
(2S)-N-butyl-2-[(2-chlorophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide (PubChem CID 100616473) has the molecular formula C30H35ClN2O2 and a molecular weight of 491.08 g/mol. Its IUPAC name is (2S)-N-butyl-2-[(2-chlorophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide.
| Compound Name | (2S)-N-butyl-2-[(2-chlorophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 100616473 |
| Molecular Formula | C30H35ClN2O2 |
| Molecular Weight | 491.08 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (2S)-N-butyl-2-[(2-chlorophenyl)methyl-[2-(3,5-dimethylphenyl)acetyl]amino]-3-phenylpropanamide |
| SMILES | CCCCNC(=O)[C@H](Cc1ccccc1)N(Cc1ccccc1Cl)C(=O)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C30H35ClN2O2/c1-4-5-15-32-30(35)28(19-24-11-7-6-8-12-24)33(21-26-13-9-10-14-27(26)31)29(34)20-25-17-22(2)16-23(3)18-25/h6-14,16-18,28H,4-5,15,19-21H2,1-3H3,(H,32,35)/t28-/m0/s1 |
| InChIKey | OWTQKWILFURBRV-NDEPHWFRSA-N |
| XLogP | 6.06 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.08 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|