C12H8N4OS2 — CID 100617019
2-pyrazin-2-yl-N-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 100617019) has the molecular formula C12H8N4OS2 and a molecular weight of 288.36 g/mol. Its IUPAC name is 2-pyrazin-2-yl-N-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-pyrazin-2-yl-N-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 100617019 |
| Molecular Formula | C12H8N4OS2 |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-pyrazin-2-yl-N-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(Nc1ccsc1)c1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C12H8N4OS2/c17-11(15-8-1-4-18-6-8)10-7-19-12(16-10)9-5-13-2-3-14-9/h1-7H,(H,15,17) |
| InChIKey | BSEAVMKQWRKGSG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |