C13H14N4O3S — CID 120534939
4-[(2-pyrazin-2-yl-1,3-thiazole-4-carbonyl)amino]pentanoic acid (PubChem CID 120534939) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 4-[(2-pyrazin-2-yl-1,3-thiazole-4-carbonyl)amino]pentanoic acid.
| Compound Name | 4-[(2-pyrazin-2-yl-1,3-thiazole-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 120534939 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 4-[(2-pyrazin-2-yl-1,3-thiazole-4-carbonyl)amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)c1csc(-c2cnccn2)n1 |
| InChI | InChI=1S/C13H14N4O3S/c1-8(2-3-11(18)19)16-12(20)10-7-21-13(17-10)9-6-14-4-5-15-9/h4-8H,2-3H2,1H3,(H,16,20)(H,18,19) |
| InChIKey | ZIYJVQBTSUYIKV-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 105.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |