C13H15NO4S — CID 10062255
(2E,4E)-N-hydroxy-6-(4-methoxyphenyl)sulfinylhexa-2,4-dienamide (PubChem CID 10062255) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is (2E,4E)-N-hydroxy-6-(4-methoxyphenyl)sulfinylhexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-hydroxy-6-(4-methoxyphenyl)sulfinylhexa-2,4-dienamide |
|---|---|
| PubChem CID | 10062255 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (2E,4E)-N-hydroxy-6-(4-methoxyphenyl)sulfinylhexa-2,4-dienamide |
| SMILES | COc1ccc(S(=O)C/C=C/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C13H15NO4S/c1-18-11-6-8-12(9-7-11)19(17)10-4-2-3-5-13(15)14-16/h2-9,16H,10H2,1H3,(H,14,15)/b4-2+,5-3+ |
| InChIKey | BHWJJQKFCHXYLD-ZUVMSYQZSA-N |
| XLogP | 1.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|