C21H27N5O2 — CID 100622908
N'-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]oxamide (PubChem CID 100622908) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N'-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]oxamide.
| Compound Name | N'-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 100622908 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N'-[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-N-[3-(4-ethyl-1,2,4-triazol-3-yl)phenyl]oxamide |
| SMILES | CCn1cnnc1-c1cccc(NC(=O)C(=O)N[C@@H](C)[C@H]2C[C@H]3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C21H27N5O2/c1-3-26-12-22-25-19(26)16-5-4-6-17(11-16)24-21(28)20(27)23-13(2)18-10-14-7-8-15(18)9-14/h4-6,11-15,18H,3,7-10H2,1-2H3,(H,23,27)(H,24,28)/t13-,14-,15-,18+/m0/s1 |
| InChIKey | HVDZYFWXECCUHL-YRBFXIGRSA-N |
| XLogP | 2.84 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|