C16H28N2O2S — CID 100625441
1-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanone (PubChem CID 100625441) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 1-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanone.
| Compound Name | 1-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanone |
|---|---|
| PubChem CID | 100625441 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1-[(4R,4aS,8aS)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-(1-oxo-1,4-thiazinan-4-yl)ethanone |
| SMILES | C[C@@H]1CCN(C(=O)CN2CCS(=O)CC2)[C@H]2CCCC[C@@H]12 |
| InChI | InChI=1S/C16H28N2O2S/c1-13-6-7-18(15-5-3-2-4-14(13)15)16(19)12-17-8-10-21(20)11-9-17/h13-15H,2-12H2,1H3/t13-,14+,15+/m1/s1 |
| InChIKey | PEBULKPXZKQPKS-ILXRZTDVSA-N |
| XLogP | 1.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |