C19H31NO4 — CID 71887972
[2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate (PubChem CID 71887972) has the molecular formula C19H31NO4 and a molecular weight of 337.46 g/mol. Its IUPAC name is [2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate.
| Compound Name | [2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71887972 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | [2-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-2-oxoethyl] 1-hydroxycyclohexane-1-carboxylate |
| SMILES | CC1CCN(C(=O)COC(=O)C2(O)CCCCC2)C2CCCCC12 |
| InChI | InChI=1S/C19H31NO4/c1-14-9-12-20(16-8-4-3-7-15(14)16)17(21)13-24-18(22)19(23)10-5-2-6-11-19/h14-16,23H,2-13H2,1H3 |
| InChIKey | QDBXSENWZKOMAR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |