C18H27N3O5 — CID 124740392
[2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoate (PubChem CID 124740392) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is [2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoate.
| Compound Name | [2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoate |
|---|---|
| PubChem CID | 124740392 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | [2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 3-[(4S)-2,5-dioxoimidazolidin-4-yl]propanoate |
| SMILES | C[C@@H]1CCN(C(=O)COC(=O)CC[C@@H]2NC(=O)NC2=O)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C18H27N3O5/c1-11-8-9-21(14-5-3-2-4-12(11)14)15(22)10-26-16(23)7-6-13-17(24)20-18(25)19-13/h11-14H,2-10H2,1H3,(H2,19,20,24,25)/t11-,12-,13+,14-/m1/s1 |
| InChIKey | URNZGWIBBCUDIW-YIYPIFLZSA-N |
| XLogP | 0.94 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|