C21H28N2O4 — CID 97092502
[2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carboxylate (PubChem CID 97092502) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is [2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carboxylate.
| Compound Name | [2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 97092502 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | [2-[(4R,4aR,8aR)-4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-2-oxoethyl] 2-oxo-1,5,6,7-tetrahydrocyclopenta[b]pyridine-3-carboxylate |
| SMILES | C[C@@H]1CCN(C(=O)COC(=O)c2cc3c([nH]c2=O)CCC3)[C@@H]2CCCC[C@H]12 |
| InChI | InChI=1S/C21H28N2O4/c1-13-9-10-23(18-8-3-2-6-15(13)18)19(24)12-27-21(26)16-11-14-5-4-7-17(14)22-20(16)25/h11,13,15,18H,2-10,12H2,1H3,(H,22,25)/t13-,15-,18-/m1/s1 |
| InChIKey | JRUQWKXGNRZIFA-DDUZABMNSA-N |
| XLogP | 2.45 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |