C15H20F3NO — CID 100629903
(2S)-2-(2,4-dimethylphenyl)-4-(3,3,3-trifluoropropyl)morpholine (PubChem CID 100629903) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is (2S)-2-(2,4-dimethylphenyl)-4-(3,3,3-trifluoropropyl)morpholine.
| Compound Name | (2S)-2-(2,4-dimethylphenyl)-4-(3,3,3-trifluoropropyl)morpholine |
|---|---|
| PubChem CID | 100629903 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (2S)-2-(2,4-dimethylphenyl)-4-(3,3,3-trifluoropropyl)morpholine |
| SMILES | Cc1ccc([C@H]2CN(CCC(F)(F)F)CCO2)c(C)c1 |
| InChI | InChI=1S/C15H20F3NO/c1-11-3-4-13(12(2)9-11)14-10-19(7-8-20-14)6-5-15(16,17)18/h3-4,9,14H,5-8,10H2,1-2H3/t14-/m1/s1 |
| InChIKey | IVGAGQFJDYONSM-CQSZACIVSA-N |
| XLogP | 3.63 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |