C15H19N3O5 — CID 100631649
(5S)-3-[(3-ethoxy-4-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione (PubChem CID 100631649) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is (5S)-3-[(3-ethoxy-4-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[(3-ethoxy-4-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 100631649 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (5S)-3-[(3-ethoxy-4-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@@H]1NC(=O)N(Cc2ccc([N+](=O)[O-])c(OCC)c2)C1=O |
| InChI | InChI=1S/C15H19N3O5/c1-3-5-11-14(19)17(15(20)16-11)9-10-6-7-12(18(21)22)13(8-10)23-4-2/h6-8,11H,3-5,9H2,1-2H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | GEZZQFOZVMEQPV-NSHDSACASA-N |
| XLogP | 2.21 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|