C13H16N4O4 — CID 107351753
3-[(2-amino-3-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione (PubChem CID 107351753) has the molecular formula C13H16N4O4 and a molecular weight of 292.30 g/mol. Its IUPAC name is 3-[(2-amino-3-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-amino-3-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 107351753 |
| Molecular Formula | C13H16N4O4 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-[(2-amino-3-nitrophenyl)methyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1NC(=O)N(Cc2cccc([N+](=O)[O-])c2N)C1=O |
| InChI | InChI=1S/C13H16N4O4/c1-2-4-9-12(18)16(13(19)15-9)7-8-5-3-6-10(11(8)14)17(20)21/h3,5-6,9H,2,4,7,14H2,1H3,(H,15,19) |
| InChIKey | UICPHZHFTYPGCO-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|