C14H16FN3O2S — CID 107115776
3-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107115776) has the molecular formula C14H16FN3O2S and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 3-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107115776 |
| Molecular Formula | C14H16FN3O2S |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-[(2,5-dioxo-4-propylimidazolidin-1-yl)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | CCCC1NC(=O)N(Cc2cccc(C(N)=S)c2F)C1=O |
| InChI | InChI=1S/C14H16FN3O2S/c1-2-4-10-13(19)18(14(20)17-10)7-8-5-3-6-9(11(8)15)12(16)21/h3,5-6,10H,2,4,7H2,1H3,(H2,16,21)(H,17,20) |
| InChIKey | GAPWIGZKAUUYQL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|