C13H13FN2O2S — CID 107115822
3-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107115822) has the molecular formula C13H13FN2O2S and a molecular weight of 280.32 g/mol. Its IUPAC name is 3-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 3-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107115822 |
| Molecular Formula | C13H13FN2O2S |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-[(2,6-dioxopiperidin-1-yl)methyl]-2-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CN2C(=O)CCCC2=O)c1F |
| InChI | InChI=1S/C13H13FN2O2S/c14-12-8(3-1-4-9(12)13(15)19)7-16-10(17)5-2-6-11(16)18/h1,3-4H,2,5-7H2,(H2,15,19) |
| InChIKey | WISRVHKCTHXGES-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|