C19H20N4OS — CID 100636951
1-(3-methoxyphenyl)-3-[[2-(2-methylimidazol-1-yl)phenyl]methyl]thiourea (PubChem CID 100636951) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-[[2-(2-methylimidazol-1-yl)phenyl]methyl]thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-[[2-(2-methylimidazol-1-yl)phenyl]methyl]thiourea |
|---|---|
| PubChem CID | 100636951 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-[[2-(2-methylimidazol-1-yl)phenyl]methyl]thiourea |
| SMILES | COc1cccc(NC(=S)NCc2ccccc2-n2ccnc2C)c1 |
| InChI | InChI=1S/C19H20N4OS/c1-14-20-10-11-23(14)18-9-4-3-6-15(18)13-21-19(25)22-16-7-5-8-17(12-16)24-2/h3-12H,13H2,1-2H3,(H2,21,22,25) |
| InChIKey | WIAGPBQUCFALFO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|