C22H23N5OS — CID 100637696
1-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea (PubChem CID 100637696) has the molecular formula C22H23N5OS and a molecular weight of 405.53 g/mol. Its IUPAC name is 1-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea.
| Compound Name | 1-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
|---|---|
| PubChem CID | 100637696 |
| Molecular Formula | C22H23N5OS |
| Molecular Weight | 405.53 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | 1-[[2-(2-methylimidazol-1-yl)phenyl]methyl]-3-[4-(2-oxopyrrolidin-1-yl)phenyl]thiourea |
| SMILES | Cc1nccn1-c1ccccc1CNC(=S)Nc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H23N5OS/c1-16-23-12-14-26(16)20-6-3-2-5-17(20)15-24-22(29)25-18-8-10-19(11-9-18)27-13-4-7-21(27)28/h2-3,5-6,8-12,14H,4,7,13,15H2,1H3,(H2,24,25,29) |
| InChIKey | FXCBRNJHCVMVMC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.53 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|