C23H23FN4O2 — CID 47738642
N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide (PubChem CID 47738642) has the molecular formula C23H23FN4O2 and a molecular weight of 406.46 g/mol. Its IUPAC name is N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide.
| Compound Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide |
|---|---|
| PubChem CID | 47738642 |
| Molecular Formula | C23H23FN4O2 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]methyl]-4-(2-oxopiperidin-1-yl)benzamide |
| SMILES | Cc1nccn1-c1ccc(CNC(=O)c2ccc(N3CCCCC3=O)cc2)cc1F |
| InChI | InChI=1S/C23H23FN4O2/c1-16-25-11-13-27(16)21-10-5-17(14-20(21)24)15-26-23(30)18-6-8-19(9-7-18)28-12-3-2-4-22(28)29/h5-11,13-14H,2-4,12,15H2,1H3,(H,26,30) |
| InChIKey | AMTAVVVTEBNHRQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |