C19H31N3O4 — CID 100637047
tert-butyl 4-[2-[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]ethyl]piperidine-1-carboxylate (PubChem CID 100637047) has the molecular formula C19H31N3O4 and a molecular weight of 365.47 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 100637047 |
| Molecular Formula | C19H31N3O4 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | tert-butyl 4-[2-[(4S)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCN2C(=O)N[C@@](C)(C3CC3)C2=O)CC1 |
| InChI | InChI=1S/C19H31N3O4/c1-18(2,3)26-17(25)21-10-7-13(8-11-21)9-12-22-15(23)19(4,14-5-6-14)20-16(22)24/h13-14H,5-12H2,1-4H3,(H,20,24)/t19-/m0/s1 |
| InChIKey | MPASODSCSKTMKT-IBGZPJMESA-N |
| XLogP | 2.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|