C17H23ClFNO2 — CID 100642461
1-[(2-chloro-5-fluorophenyl)methyl]-4-[[(3S)-oxolan-3-yl]methoxy]piperidine (PubChem CID 100642461) has the molecular formula C17H23ClFNO2 and a molecular weight of 327.83 g/mol. Its IUPAC name is 1-[(2-chloro-5-fluorophenyl)methyl]-4-[[(3S)-oxolan-3-yl]methoxy]piperidine.
| Compound Name | 1-[(2-chloro-5-fluorophenyl)methyl]-4-[[(3S)-oxolan-3-yl]methoxy]piperidine |
|---|---|
| PubChem CID | 100642461 |
| Molecular Formula | C17H23ClFNO2 |
| Molecular Weight | 327.83 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[(2-chloro-5-fluorophenyl)methyl]-4-[[(3S)-oxolan-3-yl]methoxy]piperidine |
| SMILES | Fc1ccc(Cl)c(CN2CCC(OC[C@H]3CCOC3)CC2)c1 |
| InChI | InChI=1S/C17H23ClFNO2/c18-17-2-1-15(19)9-14(17)10-20-6-3-16(4-7-20)22-12-13-5-8-21-11-13/h1-2,9,13,16H,3-8,10-12H2/t13-/m0/s1 |
| InChIKey | BTGZXFCZFBAAMY-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.83 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |