C16H20ClFN2O — CID 100642697
(4S)-4-[(2S)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]pyrrolidin-2-one (PubChem CID 100642697) has the molecular formula C16H20ClFN2O and a molecular weight of 310.80 g/mol. Its IUPAC name is (4S)-4-[(2S)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]pyrrolidin-2-one.
| Compound Name | (4S)-4-[(2S)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 100642697 |
| Molecular Formula | C16H20ClFN2O |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | (4S)-4-[(2S)-1-[(2-chloro-5-fluorophenyl)methyl]piperidin-2-yl]pyrrolidin-2-one |
| SMILES | O=C1C[C@H]([C@@H]2CCCCN2Cc2cc(F)ccc2Cl)CN1 |
| InChI | InChI=1S/C16H20ClFN2O/c17-14-5-4-13(18)7-12(14)10-20-6-2-1-3-15(20)11-8-16(21)19-9-11/h4-5,7,11,15H,1-3,6,8-10H2,(H,19,21)/t11-,15-/m0/s1 |
| InChIKey | CXYPTMPAQFSUCK-NHYWBVRUSA-N |
| XLogP | 2.97 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |