C11H22FNO2S — CID 100643975
N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-N-methylpentan-1-amine (PubChem CID 100643975) has the molecular formula C11H22FNO2S and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-N-methylpentan-1-amine.
| Compound Name | N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 100643975 |
| Molecular Formula | C11H22FNO2S |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | N-[[(3S)-1,1-dioxothiolan-3-yl]methyl]-5-fluoro-N-methylpentan-1-amine |
| SMILES | CN(CCCCCF)C[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22FNO2S/c1-13(7-4-2-3-6-12)9-11-5-8-16(14,15)10-11/h11H,2-10H2,1H3/t11-/m0/s1 |
| InChIKey | LXBNTXSYHJIFMI-NSHDSACASA-N |
| XLogP | 1.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|