C11H24FNO2S — CID 157417918
4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine (PubChem CID 157417918) has the molecular formula C11H24FNO2S and a molecular weight of 253.38 g/mol. Its IUPAC name is 4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 157417918 |
| Molecular Formula | C11H24FNO2S |
| Molecular Weight | 253.38 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | 4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCS(=O)(=O)CCC(C)(C)F |
| InChI | InChI=1S/C11H24FNO2S/c1-11(2,12)7-10-16(14,15)9-6-5-8-13(3)4/h5-10H2,1-4H3 |
| InChIKey | PACPJUXKLQYPFH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|