C11H20F6NO2S+ — CID 163967023
4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butyl-trimethylazanium (PubChem CID 163967023) has the molecular formula C11H20F6NO2S+ and a molecular weight of 344.34 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butyl-trimethylazanium.
| Compound Name | 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butyl-trimethylazanium |
|---|---|
| PubChem CID | 163967023 |
| Molecular Formula | C11H20F6NO2S+ |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butyl-trimethylazanium |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CCCC[N+](C)(C)C |
| InChI | InChI=1S/C11H20F6NO2S/c1-9(12,13)10(14,15)11(16,17)21(19,20)8-6-5-7-18(2,3)4/h5-8H2,1-4H3/q+1 |
| InChIKey | FHYPZZFAHRDYRX-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|