C11H19F6NO4S2 — CID 123950433
3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonyl-N-methyl-N-propylpropan-1-amine (PubChem CID 123950433) has the molecular formula C11H19F6NO4S2 and a molecular weight of 407.40 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonyl-N-methyl-N-propylpropan-1-amine.
| Compound Name | 3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonyl-N-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 123950433 |
| Molecular Formula | C11H19F6NO4S2 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 3-(1,1,2,2,3,3-hexafluoro-3-methylsulfonylpropyl)sulfonyl-N-methyl-N-propylpropan-1-amine |
| SMILES | CCCN(C)CCCS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(C)(=O)=O |
| InChI | InChI=1S/C11H19F6NO4S2/c1-4-6-18(2)7-5-8-24(21,22)11(16,17)9(12,13)10(14,15)23(3,19)20/h4-8H2,1-3H3 |
| InChIKey | DSCMVOOLAFRAAQ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|