C25H45F12N3O4S2 — CID 163664719
N-[3-(diethylamino)propyl]-N-ethyl-1,1,2,2,3,3-hexafluorobutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine (PubChem CID 163664719) has the molecular formula C25H45F12N3O4S2 and a molecular weight of 743.76 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-N-ethyl-1,1,2,2,3,3-hexafluorobutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine.
| Compound Name | N-[3-(diethylamino)propyl]-N-ethyl-1,1,2,2,3,3-hexafluorobutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine |
|---|---|
| PubChem CID | 163664719 |
| Molecular Formula | C25H45F12N3O4S2 |
| Molecular Weight | 743.76 g/mol |
| Exact Mass | 743.27 |
| IUPAC Name | N-[3-(diethylamino)propyl]-N-ethyl-1,1,2,2,3,3-hexafluorobutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine |
| SMILES | CCN(CC)CCCCS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F.CCN(CC)CCCN(CC)S(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C13H24F6N2O2S.C12H21F6NO2S/c1-5-20(6-2)9-8-10-21(7-3)24(22,23)13(18,19)12(16,17)11(4,14)15;1-4-19(5-2)8-6-7-9-22(20,21)12(17,18)11(15,16)10(3,13)14/h5-10H2,1-4H3;4-9H2,1-3H3 |
| InChIKey | IXKGNVPFBFUDJX-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.76 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|