C24H43F12N3O4S2 — CID 163795416
N-[3-(diethylamino)propyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine (PubChem CID 163795416) has the molecular formula C24H43F12N3O4S2 and a molecular weight of 729.73 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine.
| Compound Name | N-[3-(diethylamino)propyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine |
|---|---|
| PubChem CID | 163795416 |
| Molecular Formula | C24H43F12N3O4S2 |
| Molecular Weight | 729.73 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | N-[3-(diethylamino)propyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;N,N-diethyl-4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)butan-1-amine |
| SMILES | CCN(CC)CCCCS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F.CCN(CC)CCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C12H22F6N2O2S.C12H21F6NO2S/c1-5-20(6-2)9-7-8-19(4)23(21,22)12(17,18)11(15,16)10(3,13)14;1-4-19(5-2)8-6-7-9-22(20,21)12(17,18)11(15,16)10(3,13)14/h5-9H2,1-4H3;4-9H2,1-3H3 |
| InChIKey | NAIOSKPZMUAAJV-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.73 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|