C24H43F12N3O4S2 — CID 163589749
N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine (PubChem CID 163589749) has the molecular formula C24H43F12N3O4S2 and a molecular weight of 729.73 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine |
|---|---|
| PubChem CID | 163589749 |
| Molecular Formula | C24H43F12N3O4S2 |
| Molecular Weight | 729.73 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,1,2,2,3,3-hexafluoro-N-methylbutane-1-sulfonamide;4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N,2,2-tetramethylbutan-1-amine |
| SMILES | CN(C)CC(C)(C)CCS(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F.CN(C)CC(C)(C)CN(C)S(=O)(=O)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C12H22F6N2O2S.C12H21F6NO2S/c1-9(2,7-19(4)5)8-20(6)23(21,22)12(17,18)11(15,16)10(3,13)14;1-9(2,8-19(4)5)6-7-22(20,21)12(17,18)11(15,16)10(3,13)14/h7-8H2,1-6H3;6-8H2,1-5H3 |
| InChIKey | GONBNFJGGQTARZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.73 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|