C11H20F6N2O5S3 — CID 158737367
bis(trifluoromethylsulfonyl)azanide;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium (PubChem CID 158737367) has the molecular formula C11H20F6N2O5S3 and a molecular weight of 470.48 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium |
|---|---|
| PubChem CID | 158737367 |
| Molecular Formula | C11H20F6N2O5S3 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-(2-ethylsulfinylethyl)-1-methylpyrrolidin-1-ium |
| SMILES | CCS(=O)CC[N+]1(C)CCCC1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H20NOS.C2F6NO4S2/c1-3-12(11)9-8-10(2)6-4-5-7-10;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h3-9H2,1-2H3;/q+1;-1 |
| InChIKey | ILVRBENWCJILGK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 99.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|