C18H32F10N2O4S2 — CID 159067048
bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tributyl(ethyl)azanium (PubChem CID 159067048) has the molecular formula C18H32F10N2O4S2 and a molecular weight of 594.58 g/mol. Its IUPAC name is bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tributyl(ethyl)azanium.
| Compound Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tributyl(ethyl)azanium |
|---|---|
| PubChem CID | 159067048 |
| Molecular Formula | C18H32F10N2O4S2 |
| Molecular Weight | 594.58 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | bis(1,1,2,2,2-pentafluoroethylsulfonyl)azanide;tributyl(ethyl)azanium |
| SMILES | CCCC[N+](CC)(CCCC)CCCC.O=S(=O)([N-]S(=O)(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H32N.C4F10NO4S2/c1-5-9-12-15(8-4,13-10-6-2)14-11-7-3;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h5-14H2,1-4H3;/q+1;-1 |
| InChIKey | JZEMGXMVYNVDSX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 82.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.58 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|