C10H16F10N2O4S2 — CID 44152150
Ethanesulfonamide, 1,1,2,2,2-pentafluoro-N-((1,1,2,2,2-pentafluoroethyl)sulfonyl)-, compd. with N,N-diethylethanamine (1:1) (PubChem CID 44152150) has the molecular formula C10H16F10N2O4S2 and a molecular weight of 482.40 g/mol. Its IUPAC name is N,N-diethylethanamine;1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethylsulfonyl)ethanesulfonamide.
| Compound Name | Ethanesulfonamide, 1,1,2,2,2-pentafluoro-N-((1,1,2,2,2-pentafluoroethyl)sulfonyl)-, compd. with N,N-diethylethanamine (1:1) |
|---|---|
| PubChem CID | 44152150 |
| Molecular Formula | C10H16F10N2O4S2 |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | N,N-diethylethanamine;1,1,2,2,2-pentafluoro-N-(1,1,2,2,2-pentafluoroethylsulfonyl)ethanesulfonamide |
| SMILES | CCN(CC)CC.C(C(F)(F)S(=O)(=O)NS(=O)(=O)C(C(F)(F)F)(F)F)(F)(F)F |
| InChI | InChI=1S/C6H15N.C4HF10NO4S2/c1-4-7(5-2)6-3;5-1(6,7)3(11,12)20(16,17)15-21(18,19)4(13,14)2(8,9)10/h4-6H2,1-3H3;15H |
| InChIKey | AGUUDALNHFNOEH-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 100.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | 559 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|