C16H28F9N2O5S2+ — CID 162770359
diethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(4-sulfobutyl)azanium (PubChem CID 162770359) has the molecular formula C16H28F9N2O5S2+ and a molecular weight of 563.53 g/mol. Its IUPAC name is diethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(4-sulfobutyl)azanium.
| Compound Name | diethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(4-sulfobutyl)azanium |
|---|---|
| PubChem CID | 162770359 |
| Molecular Formula | C16H28F9N2O5S2+ |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | diethyl-[3-[methyl(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonyl)amino]propyl]-(4-sulfobutyl)azanium |
| SMILES | CC[N+](CC)(CCCCS(=O)(=O)O)CCCN(C)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H27F9N2O5S2/c1-4-27(5-2,10-6-7-12-33(28,29)30)11-8-9-26(3)34(31,32)16(24,25)14(19,20)13(17,18)15(21,22)23/h4-12H2,1-3H3/p+1 |
| InChIKey | KJHCHRBJRPDSIW-UHFFFAOYSA-O |
| XLogP | 3.59 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|