C10H17F6NO3S — CID 163899823
4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N-dimethylbutan-1-amine oxide (PubChem CID 163899823) has the molecular formula C10H17F6NO3S and a molecular weight of 345.31 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N-dimethylbutan-1-amine oxide.
| Compound Name | 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N-dimethylbutan-1-amine oxide |
|---|---|
| PubChem CID | 163899823 |
| Molecular Formula | C10H17F6NO3S |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-(1,1,2,2,3,3-hexafluorobutylsulfonyl)-N,N-dimethylbutan-1-amine oxide |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)S(=O)(=O)CCCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C10H17F6NO3S/c1-8(11,12)9(13,14)10(15,16)21(19,20)7-5-4-6-17(2,3)18/h4-7H2,1-3H3 |
| InChIKey | DPWWONFJBWVRNS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|