C11H24FNO3S — CID 157417919
4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine oxide (PubChem CID 157417919) has the molecular formula C11H24FNO3S and a molecular weight of 269.38 g/mol. Its IUPAC name is 4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine oxide.
| Compound Name | 4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine oxide |
|---|---|
| PubChem CID | 157417919 |
| Molecular Formula | C11H24FNO3S |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 4-(3-fluoro-3-methylbutyl)sulfonyl-N,N-dimethylbutan-1-amine oxide |
| SMILES | CC(C)(F)CCS(=O)(=O)CCCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C11H24FNO3S/c1-11(2,12)7-10-17(15,16)9-6-5-8-13(3,4)14/h5-10H2,1-4H3 |
| InChIKey | FAZIDYBYPYPFCF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|